C15H18Cl2O2S — CID 79899757
(3,4-dichlorophenyl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanol (PubChem CID 79899757) has the molecular formula C15H18Cl2O2S and a molecular weight of 333.28 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanol.
| Compound Name | (3,4-dichlorophenyl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanol |
|---|---|
| PubChem CID | 79899757 |
| Molecular Formula | C15H18Cl2O2S |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | (3,4-dichlorophenyl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanol |
| SMILES | OC(c1ccc(Cl)c(Cl)c1)C1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C15H18Cl2O2S/c16-12-2-1-10(7-13(12)17)14(18)11-3-5-19-15(8-11)4-6-20-9-15/h1-2,7,11,14,18H,3-6,8-9H2 |
| InChIKey | ANDCOFRIFQVCOQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |