C16H21ClFNOS — CID 79909488
1-(3-chloro-4-fluorophenyl)-N-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanamine (PubChem CID 79909488) has the molecular formula C16H21ClFNOS and a molecular weight of 329.87 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-N-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanamine.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-N-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanamine |
|---|---|
| PubChem CID | 79909488 |
| Molecular Formula | C16H21ClFNOS |
| Molecular Weight | 329.87 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-N-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanamine |
| SMILES | CNC(c1ccc(F)c(Cl)c1)C1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C16H21ClFNOS/c1-19-15(11-2-3-14(18)13(17)8-11)12-4-6-20-16(9-12)5-7-21-10-16/h2-3,8,12,15,19H,4-7,9-10H2,1H3 |
| InChIKey | XQUPFDHZKDYXKQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.87 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |