C17H24BrNOS — CID 79907540
1-(3-bromophenyl)-N-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine (PubChem CID 79907540) has the molecular formula C17H24BrNOS and a molecular weight of 370.36 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine.
| Compound Name | 1-(3-bromophenyl)-N-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine |
|---|---|
| PubChem CID | 79907540 |
| Molecular Formula | C17H24BrNOS |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 1-(3-bromophenyl)-N-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine |
| SMILES | CNC(c1cccc(Br)c1)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C17H24BrNOS/c1-19-16(13-3-2-4-15(18)11-13)14-5-8-20-17(12-14)6-9-21-10-7-17/h2-4,11,14,16,19H,5-10,12H2,1H3 |
| InChIKey | KEKCYZSULSXBGR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |