C17H27NOS2 — CID 105017996
1-(3-ethylthiophen-2-yl)-N-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine (PubChem CID 105017996) has the molecular formula C17H27NOS2 and a molecular weight of 325.54 g/mol. Its IUPAC name is 1-(3-ethylthiophen-2-yl)-N-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine.
| Compound Name | 1-(3-ethylthiophen-2-yl)-N-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine |
|---|---|
| PubChem CID | 105017996 |
| Molecular Formula | C17H27NOS2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1-(3-ethylthiophen-2-yl)-N-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine |
| SMILES | CCc1ccsc1C(NC)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C17H27NOS2/c1-3-13-5-9-21-16(13)15(18-2)14-4-8-19-17(12-14)6-10-20-11-7-17/h5,9,14-15,18H,3-4,6-8,10-12H2,1-2H3 |
| InChIKey | IMWAMVGJGCTXSZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |