C12H23NOS — CID 79914536
N-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethanamine (PubChem CID 79914536) has the molecular formula C12H23NOS and a molecular weight of 229.39 g/mol. Its IUPAC name is N-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethanamine.
| Compound Name | N-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethanamine |
|---|---|
| PubChem CID | 79914536 |
| Molecular Formula | C12H23NOS |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | N-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethanamine |
| SMILES | CNC(C)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C12H23NOS/c1-10(13-2)11-3-6-14-12(9-11)4-7-15-8-5-12/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | UQPHLSRZXNYACZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |