C13H24O4S — CID 79912513
2,2-dimethoxy-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethanol (PubChem CID 79912513) has the molecular formula C13H24O4S and a molecular weight of 276.40 g/mol. Its IUPAC name is 2,2-dimethoxy-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethanol.
| Compound Name | 2,2-dimethoxy-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethanol |
|---|---|
| PubChem CID | 79912513 |
| Molecular Formula | C13H24O4S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2,2-dimethoxy-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethanol |
| SMILES | COC(OC)C(O)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C13H24O4S/c1-15-12(16-2)11(14)10-3-6-17-13(9-10)4-7-18-8-5-13/h10-12,14H,3-9H2,1-2H3 |
| InChIKey | XSBHIBZJRSUYTM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|