C17H24O3S — CID 103459513
1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)-2-phenylethane-1,2-diol (PubChem CID 103459513) has the molecular formula C17H24O3S and a molecular weight of 308.44 g/mol. Its IUPAC name is 1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)-2-phenylethane-1,2-diol.
| Compound Name | 1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)-2-phenylethane-1,2-diol |
|---|---|
| PubChem CID | 103459513 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)-2-phenylethane-1,2-diol |
| SMILES | OC(c1ccccc1)C(O)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C17H24O3S/c18-15(13-4-2-1-3-5-13)16(19)14-6-9-20-17(12-14)7-10-21-11-8-17/h1-5,14-16,18-19H,6-12H2 |
| InChIKey | IXVRTBPFLLSKGK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |