C17H24O3 — CID 103459515
1-(6-oxaspiro[4.5]decan-9-yl)-2-phenylethane-1,2-diol (PubChem CID 103459515) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-(6-oxaspiro[4.5]decan-9-yl)-2-phenylethane-1,2-diol.
| Compound Name | 1-(6-oxaspiro[4.5]decan-9-yl)-2-phenylethane-1,2-diol |
|---|---|
| PubChem CID | 103459515 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 1-(6-oxaspiro[4.5]decan-9-yl)-2-phenylethane-1,2-diol |
| SMILES | OC(c1ccccc1)C(O)C1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C17H24O3/c18-15(13-6-2-1-3-7-13)16(19)14-8-11-20-17(12-14)9-4-5-10-17/h1-3,6-7,14-16,18-19H,4-5,8-12H2 |
| InChIKey | GCSKPUCVHGMGEI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |