C18H26O2S — CID 104846100
2-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)-1-phenylpropan-1-ol (PubChem CID 104846100) has the molecular formula C18H26O2S and a molecular weight of 306.47 g/mol. Its IUPAC name is 2-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)-1-phenylpropan-1-ol.
| Compound Name | 2-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 104846100 |
| Molecular Formula | C18H26O2S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)-1-phenylpropan-1-ol |
| SMILES | CC(C1CCOC2(CCSCC2)C1)C(O)c1ccccc1 |
| InChI | InChI=1S/C18H26O2S/c1-14(17(19)15-5-3-2-4-6-15)16-7-10-20-18(13-16)8-11-21-12-9-18/h2-6,14,16-17,19H,7-13H2,1H3 |
| InChIKey | AIOLTVAFHIMBFZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |