C18H26O2 — CID 79913678
1-(5-oxaspiro[3.5]nonan-8-yl)-3-phenylbutan-1-ol (PubChem CID 79913678) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 1-(5-oxaspiro[3.5]nonan-8-yl)-3-phenylbutan-1-ol.
| Compound Name | 1-(5-oxaspiro[3.5]nonan-8-yl)-3-phenylbutan-1-ol |
|---|---|
| PubChem CID | 79913678 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 1-(5-oxaspiro[3.5]nonan-8-yl)-3-phenylbutan-1-ol |
| SMILES | CC(CC(O)C1CCOC2(CCC2)C1)c1ccccc1 |
| InChI | InChI=1S/C18H26O2/c1-14(15-6-3-2-4-7-15)12-17(19)16-8-11-20-18(13-16)9-5-10-18/h2-4,6-7,14,16-17,19H,5,8-13H2,1H3 |
| InChIKey | YQTVQZIANDPFGR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |