C16H20F2O2 — CID 115527624
[3-(difluoromethyl)phenyl]-(5-oxaspiro[3.5]nonan-8-yl)methanol (PubChem CID 115527624) has the molecular formula C16H20F2O2 and a molecular weight of 282.33 g/mol. Its IUPAC name is [3-(difluoromethyl)phenyl]-(5-oxaspiro[3.5]nonan-8-yl)methanol.
| Compound Name | [3-(difluoromethyl)phenyl]-(5-oxaspiro[3.5]nonan-8-yl)methanol |
|---|---|
| PubChem CID | 115527624 |
| Molecular Formula | C16H20F2O2 |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | [3-(difluoromethyl)phenyl]-(5-oxaspiro[3.5]nonan-8-yl)methanol |
| SMILES | OC(c1cccc(C(F)F)c1)C1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C16H20F2O2/c17-15(18)12-4-1-3-11(9-12)14(19)13-5-8-20-16(10-13)6-2-7-16/h1,3-4,9,13-15,19H,2,5-8,10H2 |
| InChIKey | KMSSIEFYDYZJBY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |