C15H19IO2 — CID 115819602
(3-iodophenyl)-(5-oxaspiro[3.5]nonan-8-yl)methanol (PubChem CID 115819602) has the molecular formula C15H19IO2 and a molecular weight of 358.22 g/mol. Its IUPAC name is (3-iodophenyl)-(5-oxaspiro[3.5]nonan-8-yl)methanol.
| Compound Name | (3-iodophenyl)-(5-oxaspiro[3.5]nonan-8-yl)methanol |
|---|---|
| PubChem CID | 115819602 |
| Molecular Formula | C15H19IO2 |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | (3-iodophenyl)-(5-oxaspiro[3.5]nonan-8-yl)methanol |
| SMILES | OC(c1cccc(I)c1)C1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C15H19IO2/c16-13-4-1-3-11(9-13)14(17)12-5-8-18-15(10-12)6-2-7-15/h1,3-4,9,12,14,17H,2,5-8,10H2 |
| InChIKey | VQDXARBMCIHESN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|