C15H22O3S — CID 104800791
(3-methylfuran-2-yl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanol (PubChem CID 104800791) has the molecular formula C15H22O3S and a molecular weight of 282.40 g/mol. Its IUPAC name is (3-methylfuran-2-yl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanol.
| Compound Name | (3-methylfuran-2-yl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanol |
|---|---|
| PubChem CID | 104800791 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (3-methylfuran-2-yl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanol |
| SMILES | Cc1ccoc1C(O)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C15H22O3S/c1-11-2-6-17-14(11)13(16)12-3-7-18-15(10-12)4-8-19-9-5-15/h2,6,12-13,16H,3-5,7-10H2,1H3 |
| InChIKey | RFEQEPYOBNPRFJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |