C16H24O3 — CID 104800788
(3-methylfuran-2-yl)-(1-oxaspiro[5.5]undecan-4-yl)methanol (PubChem CID 104800788) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (3-methylfuran-2-yl)-(1-oxaspiro[5.5]undecan-4-yl)methanol.
| Compound Name | (3-methylfuran-2-yl)-(1-oxaspiro[5.5]undecan-4-yl)methanol |
|---|---|
| PubChem CID | 104800788 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (3-methylfuran-2-yl)-(1-oxaspiro[5.5]undecan-4-yl)methanol |
| SMILES | Cc1ccoc1C(O)C1CCOC2(CCCCC2)C1 |
| InChI | InChI=1S/C16H24O3/c1-12-5-9-18-15(12)14(17)13-6-10-19-16(11-13)7-3-2-4-8-16/h5,9,13-14,17H,2-4,6-8,10-11H2,1H3 |
| InChIKey | MNMDIMJTFOAWCS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |