C14H20O3S — CID 113453316
(2-methylfuran-3-yl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanol (PubChem CID 113453316) has the molecular formula C14H20O3S and a molecular weight of 268.38 g/mol. Its IUPAC name is (2-methylfuran-3-yl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanol.
| Compound Name | (2-methylfuran-3-yl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanol |
|---|---|
| PubChem CID | 113453316 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (2-methylfuran-3-yl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanol |
| SMILES | Cc1occc1C(O)C1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C14H20O3S/c1-10-12(3-5-16-10)13(15)11-2-6-17-14(8-11)4-7-18-9-14/h3,5,11,13,15H,2,4,6-9H2,1H3 |
| InChIKey | FDOWWTUMPMICAA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |