C13H18O2S2 — CID 79900946
6-oxa-2-thiaspiro[4.5]decan-9-yl(thiophen-3-yl)methanol (PubChem CID 79900946) has the molecular formula C13H18O2S2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 6-oxa-2-thiaspiro[4.5]decan-9-yl(thiophen-3-yl)methanol.
| Compound Name | 6-oxa-2-thiaspiro[4.5]decan-9-yl(thiophen-3-yl)methanol |
|---|---|
| PubChem CID | 79900946 |
| Molecular Formula | C13H18O2S2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 6-oxa-2-thiaspiro[4.5]decan-9-yl(thiophen-3-yl)methanol |
| SMILES | OC(c1ccsc1)C1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C13H18O2S2/c14-12(11-2-5-16-8-11)10-1-4-15-13(7-10)3-6-17-9-13/h2,5,8,10,12,14H,1,3-4,6-7,9H2 |
| InChIKey | LNZDTLRDFSMZNZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |