C17H24O3S — CID 79900352
(2-ethoxyphenyl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanol (PubChem CID 79900352) has the molecular formula C17H24O3S and a molecular weight of 308.44 g/mol. Its IUPAC name is (2-ethoxyphenyl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanol.
| Compound Name | (2-ethoxyphenyl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanol |
|---|---|
| PubChem CID | 79900352 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (2-ethoxyphenyl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanol |
| SMILES | CCOc1ccccc1C(O)C1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C17H24O3S/c1-2-19-15-6-4-3-5-14(15)16(18)13-7-9-20-17(11-13)8-10-21-12-17/h3-6,13,16,18H,2,7-12H2,1H3 |
| InChIKey | TWWLTWYLHMRFCB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |