C11H14O3 — CID 132578778
(1S,2S)-1-(oxetan-3-yl)-2-phenylethane-1,2-diol (PubChem CID 132578778) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (1S,2S)-1-(oxetan-3-yl)-2-phenylethane-1,2-diol.
| Compound Name | (1S,2S)-1-(oxetan-3-yl)-2-phenylethane-1,2-diol |
|---|---|
| PubChem CID | 132578778 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (1S,2S)-1-(oxetan-3-yl)-2-phenylethane-1,2-diol |
| SMILES | O[C@@H](c1ccccc1)[C@@H](O)C1COC1 |
| InChI | InChI=1S/C11H14O3/c12-10(8-4-2-1-3-5-8)11(13)9-6-14-7-9/h1-5,9-13H,6-7H2/t10-,11-/m0/s1 |
| InChIKey | MIXGQQKBHCXNCM-QWRGUYRKSA-N |
| XLogP | 0.73 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |