C15H22O2 — CID 103459354
1-(4-methylcyclohexyl)-2-phenylethane-1,2-diol (PubChem CID 103459354) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-(4-methylcyclohexyl)-2-phenylethane-1,2-diol.
| Compound Name | 1-(4-methylcyclohexyl)-2-phenylethane-1,2-diol |
|---|---|
| PubChem CID | 103459354 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 1-(4-methylcyclohexyl)-2-phenylethane-1,2-diol |
| SMILES | CC1CCC(C(O)C(O)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H22O2/c1-11-7-9-13(10-8-11)15(17)14(16)12-5-3-2-4-6-12/h2-6,11,13-17H,7-10H2,1H3 |
| InChIKey | VQMOSWAPBSGXCE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |