C16H24O2 — CID 101021002
(1R,2R,3R)-1-cyclohexyl-2-methyl-3-phenylpropane-1,3-diol (PubChem CID 101021002) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (1R,2R,3R)-1-cyclohexyl-2-methyl-3-phenylpropane-1,3-diol.
| Compound Name | (1R,2R,3R)-1-cyclohexyl-2-methyl-3-phenylpropane-1,3-diol |
|---|---|
| PubChem CID | 101021002 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (1R,2R,3R)-1-cyclohexyl-2-methyl-3-phenylpropane-1,3-diol |
| SMILES | C[C@H]([C@H](O)C1CCCCC1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H24O2/c1-12(15(17)13-8-4-2-5-9-13)16(18)14-10-6-3-7-11-14/h2,4-5,8-9,12,14-18H,3,6-7,10-11H2,1H3/t12-,15+,16-/m0/s1 |
| InChIKey | VKRQCUFLQPZRMC-MAZHCROVSA-N |
| XLogP | 3.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |