C16H25IOS — CID 10691895
[(1S,2R)-2-cyclohexyl-2-hydroxy-1-phenylethyl]-dimethylsulfanium iodide (PubChem CID 10691895) has the molecular formula C16H25IOS and a molecular weight of 392.35 g/mol. Its IUPAC name is [(1S,2R)-2-cyclohexyl-2-hydroxy-1-phenylethyl]-dimethylsulfanium iodide.
| Compound Name | [(1S,2R)-2-cyclohexyl-2-hydroxy-1-phenylethyl]-dimethylsulfanium iodide |
|---|---|
| PubChem CID | 10691895 |
| Molecular Formula | C16H25IOS |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | [(1S,2R)-2-cyclohexyl-2-hydroxy-1-phenylethyl]-dimethylsulfanium iodide |
| SMILES | C[S+](C)[C@@H](c1ccccc1)[C@H](O)C1CCCCC1.[I-] |
| InChI | InChI=1S/C16H25OS.HI/c1-18(2)16(14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13;/h4,7-8,11-13,15-17H,3,5-6,9-10H2,1-2H3;1H/q+1;/p-1/t15-,16+;/m1./s1 |
| InChIKey | REASBVUTILLWPW-RCPFAERMSA-M |
| XLogP | 0.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|