C14H20BrNOS2 — CID 105018106
(3-bromothiophen-2-yl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine (PubChem CID 105018106) has the molecular formula C14H20BrNOS2 and a molecular weight of 362.36 g/mol. Its IUPAC name is (3-bromothiophen-2-yl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine.
| Compound Name | (3-bromothiophen-2-yl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine |
|---|---|
| PubChem CID | 105018106 |
| Molecular Formula | C14H20BrNOS2 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | (3-bromothiophen-2-yl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine |
| SMILES | NC(c1sccc1Br)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C14H20BrNOS2/c15-11-2-6-19-13(11)12(16)10-1-5-17-14(9-10)3-7-18-8-4-14/h2,6,10,12H,1,3-5,7-9,16H2 |
| InChIKey | IHJIMJRHJYLCAG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |