C16H25NOS2 — CID 105018081
(5-ethylthiophen-2-yl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine (PubChem CID 105018081) has the molecular formula C16H25NOS2 and a molecular weight of 311.52 g/mol. Its IUPAC name is (5-ethylthiophen-2-yl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine.
| Compound Name | (5-ethylthiophen-2-yl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine |
|---|---|
| PubChem CID | 105018081 |
| Molecular Formula | C16H25NOS2 |
| Molecular Weight | 311.52 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (5-ethylthiophen-2-yl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine |
| SMILES | CCc1ccc(C(N)C2CCOC3(CCSCC3)C2)s1 |
| InChI | InChI=1S/C16H25NOS2/c1-2-13-3-4-14(20-13)15(17)12-5-8-18-16(11-12)6-9-19-10-7-16/h3-4,12,15H,2,5-11,17H2,1H3 |
| InChIKey | CGTPNAKILFOCKE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |