C17H24BrNOS — CID 105018094
(4-bromo-3-methylphenyl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine (PubChem CID 105018094) has the molecular formula C17H24BrNOS and a molecular weight of 370.36 g/mol. Its IUPAC name is (4-bromo-3-methylphenyl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine.
| Compound Name | (4-bromo-3-methylphenyl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine |
|---|---|
| PubChem CID | 105018094 |
| Molecular Formula | C17H24BrNOS |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | (4-bromo-3-methylphenyl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine |
| SMILES | Cc1cc(C(N)C2CCOC3(CCSCC3)C2)ccc1Br |
| InChI | InChI=1S/C17H24BrNOS/c1-12-10-13(2-3-15(12)18)16(19)14-4-7-20-17(11-14)5-8-21-9-6-17/h2-3,10,14,16H,4-9,11,19H2,1H3 |
| InChIKey | BVZKMZSCMYWIED-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |