C16H23NOS — CID 79914241
(3-methylphenyl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanamine (PubChem CID 79914241) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is (3-methylphenyl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanamine.
| Compound Name | (3-methylphenyl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanamine |
|---|---|
| PubChem CID | 79914241 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (3-methylphenyl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanamine |
| SMILES | Cc1cccc(C(N)C2CCOC3(CCSC3)C2)c1 |
| InChI | InChI=1S/C16H23NOS/c1-12-3-2-4-13(9-12)15(17)14-5-7-18-16(10-14)6-8-19-11-16/h2-4,9,14-15H,5-8,10-11,17H2,1H3 |
| InChIKey | PKKDDLAAZJVUCA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |