C14H20BrNOS2 — CID 79914771
1-(5-bromothiophen-2-yl)-N-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanamine (PubChem CID 79914771) has the molecular formula C14H20BrNOS2 and a molecular weight of 362.36 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-N-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanamine.
| Compound Name | 1-(5-bromothiophen-2-yl)-N-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanamine |
|---|---|
| PubChem CID | 79914771 |
| Molecular Formula | C14H20BrNOS2 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-N-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanamine |
| SMILES | CNC(c1ccc(Br)s1)C1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C14H20BrNOS2/c1-16-13(11-2-3-12(15)19-11)10-4-6-17-14(8-10)5-7-18-9-14/h2-3,10,13,16H,4-9H2,1H3 |
| InChIKey | ABSLWZFPGDXTNT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |