C16H20F2O3 — CID 79902050
[2-(difluoromethoxy)phenyl]-(5-oxaspiro[3.5]nonan-8-yl)methanol (PubChem CID 79902050) has the molecular formula C16H20F2O3 and a molecular weight of 298.33 g/mol. Its IUPAC name is [2-(difluoromethoxy)phenyl]-(5-oxaspiro[3.5]nonan-8-yl)methanol.
| Compound Name | [2-(difluoromethoxy)phenyl]-(5-oxaspiro[3.5]nonan-8-yl)methanol |
|---|---|
| PubChem CID | 79902050 |
| Molecular Formula | C16H20F2O3 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [2-(difluoromethoxy)phenyl]-(5-oxaspiro[3.5]nonan-8-yl)methanol |
| SMILES | OC(c1ccccc1OC(F)F)C1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C16H20F2O3/c17-15(18)21-13-5-2-1-4-12(13)14(19)11-6-9-20-16(10-11)7-3-8-16/h1-2,4-5,11,14-15,19H,3,6-10H2 |
| InChIKey | JIJJTUJQIIQLNO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |