C15H21IN2O — CID 105322205
[(2-iodophenyl)-(5-oxaspiro[3.5]nonan-8-yl)methyl]hydrazine (PubChem CID 105322205) has the molecular formula C15H21IN2O and a molecular weight of 372.25 g/mol. Its IUPAC name is [(2-iodophenyl)-(5-oxaspiro[3.5]nonan-8-yl)methyl]hydrazine.
| Compound Name | [(2-iodophenyl)-(5-oxaspiro[3.5]nonan-8-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105322205 |
| Molecular Formula | C15H21IN2O |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | [(2-iodophenyl)-(5-oxaspiro[3.5]nonan-8-yl)methyl]hydrazine |
| SMILES | NNC(c1ccccc1I)C1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C15H21IN2O/c16-13-5-2-1-4-12(13)14(18-17)11-6-9-19-15(10-11)7-3-8-15/h1-2,4-5,11,14,18H,3,6-10,17H2 |
| InChIKey | VQIVZBVOWPGCIR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|