C16H25N3O — CID 105279930
[(4-methyl-3-pyridinyl)-(6-oxaspiro[4.5]decan-9-yl)methyl]hydrazine (PubChem CID 105279930) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is [(4-methyl-3-pyridinyl)-(6-oxaspiro[4.5]decan-9-yl)methyl]hydrazine.
| Compound Name | [(4-methyl-3-pyridinyl)-(6-oxaspiro[4.5]decan-9-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105279930 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | [(4-methyl-3-pyridinyl)-(6-oxaspiro[4.5]decan-9-yl)methyl]hydrazine |
| SMILES | Cc1ccncc1C(NN)C1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C16H25N3O/c1-12-4-8-18-11-14(12)15(19-17)13-5-9-20-16(10-13)6-2-3-7-16/h4,8,11,13,15,19H,2-3,5-7,9-10,17H2,1H3 |
| InChIKey | VMOYNXIYCSWRDS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|