C17H27N3O — CID 105223968
2-[hydrazinyl(1-oxaspiro[5.5]undecan-4-yl)methyl]aniline (PubChem CID 105223968) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-[hydrazinyl(1-oxaspiro[5.5]undecan-4-yl)methyl]aniline.
| Compound Name | 2-[hydrazinyl(1-oxaspiro[5.5]undecan-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 105223968 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 2-[hydrazinyl(1-oxaspiro[5.5]undecan-4-yl)methyl]aniline |
| SMILES | NNC(c1ccccc1N)C1CCOC2(CCCCC2)C1 |
| InChI | InChI=1S/C17H27N3O/c18-15-7-3-2-6-14(15)16(20-19)13-8-11-21-17(12-13)9-4-1-5-10-17/h2-3,6-7,13,16,20H,1,4-5,8-12,18-19H2 |
| InChIKey | JQHPSABEGYYAEH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|