C16H22BrNO3 — CID 82697881
(2-amino-5-bromophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanol (PubChem CID 82697881) has the molecular formula C16H22BrNO3 and a molecular weight of 356.26 g/mol. Its IUPAC name is (2-amino-5-bromophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanol.
| Compound Name | (2-amino-5-bromophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanol |
|---|---|
| PubChem CID | 82697881 |
| Molecular Formula | C16H22BrNO3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | (2-amino-5-bromophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanol |
| SMILES | Nc1ccc(Br)cc1C(O)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C16H22BrNO3/c17-12-1-2-14(18)13(9-12)15(19)11-3-6-21-16(10-11)4-7-20-8-5-16/h1-2,9,11,15,19H,3-8,10,18H2 |
| InChIKey | NQHQNYAOJGWYCV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|