C16H21BrO3 — CID 79900364
(4-bromophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanol (PubChem CID 79900364) has the molecular formula C16H21BrO3 and a molecular weight of 341.25 g/mol. Its IUPAC name is (4-bromophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanol.
| Compound Name | (4-bromophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanol |
|---|---|
| PubChem CID | 79900364 |
| Molecular Formula | C16H21BrO3 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | (4-bromophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanol |
| SMILES | OC(c1ccc(Br)cc1)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C16H21BrO3/c17-14-3-1-12(2-4-14)15(18)13-5-8-20-16(11-13)6-9-19-10-7-16/h1-4,13,15,18H,5-11H2 |
| InChIKey | WWPQGNZIJGJBOJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |