C16H20Cl2O3 — CID 79898859
(2,6-dichlorophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanol (PubChem CID 79898859) has the molecular formula C16H20Cl2O3 and a molecular weight of 331.24 g/mol. Its IUPAC name is (2,6-dichlorophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanol.
| Compound Name | (2,6-dichlorophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanol |
|---|---|
| PubChem CID | 79898859 |
| Molecular Formula | C16H20Cl2O3 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | (2,6-dichlorophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanol |
| SMILES | OC(c1c(Cl)cccc1Cl)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C16H20Cl2O3/c17-12-2-1-3-13(18)14(12)15(19)11-4-7-21-16(10-11)5-8-20-9-6-16/h1-3,11,15,19H,4-10H2 |
| InChIKey | XQJHJHXBJBYMOA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |