C15H28O3S — CID 103459601
3-ethyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)pentane-1,2-diol (PubChem CID 103459601) has the molecular formula C15H28O3S and a molecular weight of 288.45 g/mol. Its IUPAC name is 3-ethyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)pentane-1,2-diol.
| Compound Name | 3-ethyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)pentane-1,2-diol |
|---|---|
| PubChem CID | 103459601 |
| Molecular Formula | C15H28O3S |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 3-ethyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)pentane-1,2-diol |
| SMILES | CCC(CC)C(O)C(O)C1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C15H28O3S/c1-3-11(4-2)13(16)14(17)12-5-7-18-15(9-12)6-8-19-10-15/h11-14,16-17H,3-10H2,1-2H3 |
| InChIKey | RNIWHFFQNMZCOJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |