C14H26O3S — CID 103449203
2-ethyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)butane-1,2-diol (PubChem CID 103449203) has the molecular formula C14H26O3S and a molecular weight of 274.43 g/mol. Its IUPAC name is 2-ethyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)butane-1,2-diol.
| Compound Name | 2-ethyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 103449203 |
| Molecular Formula | C14H26O3S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 2-ethyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)butane-1,2-diol |
| SMILES | CCC(O)(CC)C(O)C1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C14H26O3S/c1-3-14(16,4-2)12(15)11-5-7-17-13(9-11)6-8-18-10-13/h11-12,15-16H,3-10H2,1-2H3 |
| InChIKey | YRRQOHAFIHZXBD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |