C15H29NO3S — CID 79911289
2,2-diethoxy-N-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)ethanamine (PubChem CID 79911289) has the molecular formula C15H29NO3S and a molecular weight of 303.47 g/mol. Its IUPAC name is 2,2-diethoxy-N-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)ethanamine.
| Compound Name | 2,2-diethoxy-N-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)ethanamine |
|---|---|
| PubChem CID | 79911289 |
| Molecular Formula | C15H29NO3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 2,2-diethoxy-N-methyl-1-(6-oxa-2-thiaspiro[4.5]decan-9-yl)ethanamine |
| SMILES | CCOC(OCC)C(NC)C1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C15H29NO3S/c1-4-17-14(18-5-2)13(16-3)12-6-8-19-15(10-12)7-9-20-11-15/h12-14,16H,4-11H2,1-3H3 |
| InChIKey | HPPYIWMEQBTKBE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|