C12H24N2O2S — CID 105325595
[1-(2,6-dioxaspiro[4.5]decan-9-yl)-3-methylsulfanylpropyl]hydrazine (PubChem CID 105325595) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is [1-(2,6-dioxaspiro[4.5]decan-9-yl)-3-methylsulfanylpropyl]hydrazine.
| Compound Name | [1-(2,6-dioxaspiro[4.5]decan-9-yl)-3-methylsulfanylpropyl]hydrazine |
|---|---|
| PubChem CID | 105325595 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | [1-(2,6-dioxaspiro[4.5]decan-9-yl)-3-methylsulfanylpropyl]hydrazine |
| SMILES | CSCCC(NN)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C12H24N2O2S/c1-17-7-3-11(14-13)10-2-5-16-12(8-10)4-6-15-9-12/h10-11,14H,2-9,13H2,1H3 |
| InChIKey | GAMFRZVDHWKLOQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|