C16H30N2O3 — CID 105325538
[1-(2,6-dioxaspiro[4.5]decan-9-yl)-3-(oxan-2-yl)propyl]hydrazine (PubChem CID 105325538) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is [1-(2,6-dioxaspiro[4.5]decan-9-yl)-3-(oxan-2-yl)propyl]hydrazine.
| Compound Name | [1-(2,6-dioxaspiro[4.5]decan-9-yl)-3-(oxan-2-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 105325538 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | [1-(2,6-dioxaspiro[4.5]decan-9-yl)-3-(oxan-2-yl)propyl]hydrazine |
| SMILES | NNC(CCC1CCCCO1)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C16H30N2O3/c17-18-15(5-4-14-3-1-2-8-20-14)13-6-9-21-16(11-13)7-10-19-12-16/h13-15,18H,1-12,17H2 |
| InChIKey | HOUBLKLAFFDJKB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|