C16H25N3OS — CID 107504849
[(2,6-dimethyl-4-pyridinyl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methyl]hydrazine (PubChem CID 107504849) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is [(2,6-dimethyl-4-pyridinyl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methyl]hydrazine.
| Compound Name | [(2,6-dimethyl-4-pyridinyl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107504849 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | [(2,6-dimethyl-4-pyridinyl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methyl]hydrazine |
| SMILES | Cc1cc(C(NN)C2CCOC3(CCSC3)C2)cc(C)n1 |
| InChI | InChI=1S/C16H25N3OS/c1-11-7-14(8-12(2)18-11)15(19-17)13-3-5-20-16(9-13)4-6-21-10-16/h7-8,13,15,19H,3-6,9-10,17H2,1-2H3 |
| InChIKey | WDBHNOMDJLKLCZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|