C19H31N — CID 63527430
1-(4-tert-butylcyclohexyl)-2-(3-methylphenyl)ethanamine (PubChem CID 63527430) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is 1-(4-tert-butylcyclohexyl)-2-(3-methylphenyl)ethanamine.
| Compound Name | 1-(4-tert-butylcyclohexyl)-2-(3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 63527430 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 1-(4-tert-butylcyclohexyl)-2-(3-methylphenyl)ethanamine |
| SMILES | Cc1cccc(CC(N)C2CCC(C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C19H31N/c1-14-6-5-7-15(12-14)13-18(20)16-8-10-17(11-9-16)19(2,3)4/h5-7,12,16-18H,8-11,13,20H2,1-4H3 |
| InChIKey | WWBDHOVEJMIKOY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |