C11H13F4N — CID 105495790
3-fluoro-4-[3-(trifluoromethyl)phenyl]butan-2-amine (PubChem CID 105495790) has the molecular formula C11H13F4N and a molecular weight of 235.22 g/mol. Its IUPAC name is 3-fluoro-4-[3-(trifluoromethyl)phenyl]butan-2-amine.
| Compound Name | 3-fluoro-4-[3-(trifluoromethyl)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 105495790 |
| Molecular Formula | C11H13F4N |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-fluoro-4-[3-(trifluoromethyl)phenyl]butan-2-amine |
| SMILES | CC(N)C(F)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F4N/c1-7(16)10(12)6-8-3-2-4-9(5-8)11(13,14)15/h2-5,7,10H,6,16H2,1H3 |
| InChIKey | ZJNHKGWIUVRAIB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |