C11H13F4N — CID 84727054
1-[3-(1,1,2,2-tetrafluoroethyl)phenyl]propan-2-amine (PubChem CID 84727054) has the molecular formula C11H13F4N and a molecular weight of 235.22 g/mol. Its IUPAC name is 1-[3-(1,1,2,2-tetrafluoroethyl)phenyl]propan-2-amine.
| Compound Name | 1-[3-(1,1,2,2-tetrafluoroethyl)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 84727054 |
| Molecular Formula | C11H13F4N |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 1-[3-(1,1,2,2-tetrafluoroethyl)phenyl]propan-2-amine |
| SMILES | CC(N)Cc1cccc(C(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C11H13F4N/c1-7(16)5-8-3-2-4-9(6-8)11(14,15)10(12)13/h2-4,6-7,10H,5,16H2,1H3 |
| InChIKey | HGSYJWYCKQOXPW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|