C11H14F3NO3 — CID 118040884
carbonic acid;(2R)-1-[3-(trifluoromethyl)phenyl]propan-2-amine (PubChem CID 118040884) has the molecular formula C11H14F3NO3 and a molecular weight of 265.23 g/mol. Its IUPAC name is carbonic acid;(2R)-1-[3-(trifluoromethyl)phenyl]propan-2-amine.
| Compound Name | carbonic acid;(2R)-1-[3-(trifluoromethyl)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 118040884 |
| Molecular Formula | C11H14F3NO3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | carbonic acid;(2R)-1-[3-(trifluoromethyl)phenyl]propan-2-amine |
| SMILES | C[C@@H](N)Cc1cccc(C(F)(F)F)c1.O=C(O)O |
| InChI | InChI=1S/C10H12F3N.CH2O3/c1-7(14)5-8-3-2-4-9(6-8)10(11,12)13;2-1(3)4/h2-4,6-7H,5,14H2,1H3;(H2,2,3,4)/t7-;/m1./s1 |
| InChIKey | ZONCMSQPJYHFPL-OGFXRTJISA-N |
| XLogP | 2.82 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |