C14H20F3NS — CID 65132993
1-tert-butylsulfanyl-3-[3-(trifluoromethyl)phenyl]propan-2-amine (PubChem CID 65132993) has the molecular formula C14H20F3NS and a molecular weight of 291.38 g/mol. Its IUPAC name is 1-tert-butylsulfanyl-3-[3-(trifluoromethyl)phenyl]propan-2-amine.
| Compound Name | 1-tert-butylsulfanyl-3-[3-(trifluoromethyl)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 65132993 |
| Molecular Formula | C14H20F3NS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 1-tert-butylsulfanyl-3-[3-(trifluoromethyl)phenyl]propan-2-amine |
| SMILES | CC(C)(C)SCC(N)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H20F3NS/c1-13(2,3)19-9-12(18)8-10-5-4-6-11(7-10)14(15,16)17/h4-7,12H,8-9,18H2,1-3H3 |
| InChIKey | BSVHUYNSWFORGG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |