C19H31N — CID 107188307
2-(4-tert-butylphenyl)-N-methyl-1-(2-methylcyclopentyl)ethanamine (PubChem CID 107188307) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N-methyl-1-(2-methylcyclopentyl)ethanamine.
| Compound Name | 2-(4-tert-butylphenyl)-N-methyl-1-(2-methylcyclopentyl)ethanamine |
|---|---|
| PubChem CID | 107188307 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N-methyl-1-(2-methylcyclopentyl)ethanamine |
| SMILES | CNC(Cc1ccc(C(C)(C)C)cc1)C1CCCC1C |
| InChI | InChI=1S/C19H31N/c1-14-7-6-8-17(14)18(20-5)13-15-9-11-16(12-10-15)19(2,3)4/h9-12,14,17-18,20H,6-8,13H2,1-5H3 |
| InChIKey | YENDQXAKSFNXQB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |