C13H18BrN — CID 61065850
2-(4-bromophenyl)-N-methyl-1-(2-methylcyclopropyl)ethanamine (PubChem CID 61065850) has the molecular formula C13H18BrN and a molecular weight of 268.20 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-methyl-1-(2-methylcyclopropyl)ethanamine.
| Compound Name | 2-(4-bromophenyl)-N-methyl-1-(2-methylcyclopropyl)ethanamine |
|---|---|
| PubChem CID | 61065850 |
| Molecular Formula | C13H18BrN |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-(4-bromophenyl)-N-methyl-1-(2-methylcyclopropyl)ethanamine |
| SMILES | CNC(Cc1ccc(Br)cc1)C1CC1C |
| InChI | InChI=1S/C13H18BrN/c1-9-7-12(9)13(15-2)8-10-3-5-11(14)6-4-10/h3-6,9,12-13,15H,7-8H2,1-2H3 |
| InChIKey | WISHUWGCJKXYQA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |