C12H17ClN2 — CID 105235074
[2-(4-chlorophenyl)-1-(2-methylcyclopropyl)ethyl]hydrazine (PubChem CID 105235074) has the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-1-(2-methylcyclopropyl)ethyl]hydrazine.
| Compound Name | [2-(4-chlorophenyl)-1-(2-methylcyclopropyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105235074 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | [2-(4-chlorophenyl)-1-(2-methylcyclopropyl)ethyl]hydrazine |
| SMILES | CC1CC1C(Cc1ccc(Cl)cc1)NN |
| InChI | InChI=1S/C12H17ClN2/c1-8-6-11(8)12(15-14)7-9-2-4-10(13)5-3-9/h2-5,8,11-12,15H,6-7,14H2,1H3 |
| InChIKey | FDFHEXIUBRLFGG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|