C16H25ClN2 — CID 105231866
[2-(4-chlorophenyl)-1-(4,4-dimethylcyclohexyl)ethyl]hydrazine (PubChem CID 105231866) has the molecular formula C16H25ClN2 and a molecular weight of 280.84 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-1-(4,4-dimethylcyclohexyl)ethyl]hydrazine.
| Compound Name | [2-(4-chlorophenyl)-1-(4,4-dimethylcyclohexyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105231866 |
| Molecular Formula | C16H25ClN2 |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | [2-(4-chlorophenyl)-1-(4,4-dimethylcyclohexyl)ethyl]hydrazine |
| SMILES | CC1(C)CCC(C(Cc2ccc(Cl)cc2)NN)CC1 |
| InChI | InChI=1S/C16H25ClN2/c1-16(2)9-7-13(8-10-16)15(19-18)11-12-3-5-14(17)6-4-12/h3-6,13,15,19H,7-11,18H2,1-2H3 |
| InChIKey | QJVXFBDGOAEELU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|