C16H24ClFN2 — CID 107895103
[2-(4-chloro-3-fluorophenyl)-1-(4,4-dimethylcyclohexyl)ethyl]hydrazine (PubChem CID 107895103) has the molecular formula C16H24ClFN2 and a molecular weight of 298.83 g/mol. Its IUPAC name is [2-(4-chloro-3-fluorophenyl)-1-(4,4-dimethylcyclohexyl)ethyl]hydrazine.
| Compound Name | [2-(4-chloro-3-fluorophenyl)-1-(4,4-dimethylcyclohexyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107895103 |
| Molecular Formula | C16H24ClFN2 |
| Molecular Weight | 298.83 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | [2-(4-chloro-3-fluorophenyl)-1-(4,4-dimethylcyclohexyl)ethyl]hydrazine |
| SMILES | CC1(C)CCC(C(Cc2ccc(Cl)c(F)c2)NN)CC1 |
| InChI | InChI=1S/C16H24ClFN2/c1-16(2)7-5-12(6-8-16)15(20-19)10-11-3-4-13(17)14(18)9-11/h3-4,9,12,15,20H,5-8,10,19H2,1-2H3 |
| InChIKey | QBXZINLGXBOTAS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.83 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|