C12H17ClN2S2 — CID 105249447
[2-(4-chlorophenyl)-1-(1,4-dithian-2-yl)ethyl]hydrazine (PubChem CID 105249447) has the molecular formula C12H17ClN2S2 and a molecular weight of 288.87 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-1-(1,4-dithian-2-yl)ethyl]hydrazine.
| Compound Name | [2-(4-chlorophenyl)-1-(1,4-dithian-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105249447 |
| Molecular Formula | C12H17ClN2S2 |
| Molecular Weight | 288.87 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | [2-(4-chlorophenyl)-1-(1,4-dithian-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(Cl)cc1)C1CSCCS1 |
| InChI | InChI=1S/C12H17ClN2S2/c13-10-3-1-9(2-4-10)7-11(15-14)12-8-16-5-6-17-12/h1-4,11-12,15H,5-8,14H2 |
| InChIKey | YRSSGXBSBXZDNL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.87 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|